C29H29IN2O5 — CID 89340230
2-[(1S,5R,6S,9R,10R)-4-(cyclopropylmethyl)-6,13-dihydroxy-16-methyl-11-oxa-4-azapentacyclo[8.7.0.01,6.03,5.012,17]heptadeca-12,14,16-trien-9-yl]-5-(iodomethyl)isoindole-1,3-dione (PubChem CID 89340230) has the molecular formula C29H29IN2O5 and a molecular weight of 612.46 g/mol. Its IUPAC name is 2-[(1S,5R,6S,9R,10R)-4-(cyclopropylmethyl)-6,13-dihydroxy-16-methyl-11-oxa-4-azapentacyclo[8.7.0.01,6.03,5.012,17]heptadeca-12,14,16-trien-9-yl]-5-(iodomethyl)isoindole-1,3-dione.
| Compound Name | 2-[(1S,5R,6S,9R,10R)-4-(cyclopropylmethyl)-6,13-dihydroxy-16-methyl-11-oxa-4-azapentacyclo[8.7.0.01,6.03,5.012,17]heptadeca-12,14,16-trien-9-yl]-5-(iodomethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 89340230 |
| Molecular Formula | C29H29IN2O5 |
| Molecular Weight | 612.46 g/mol |
| Exact Mass | 612.11 |
| IUPAC Name | 2-[(1S,5R,6S,9R,10R)-4-(cyclopropylmethyl)-6,13-dihydroxy-16-methyl-11-oxa-4-azapentacyclo[8.7.0.01,6.03,5.012,17]heptadeca-12,14,16-trien-9-yl]-5-(iodomethyl)isoindole-1,3-dione |
| SMILES | Cc1ccc(O)c2c1[C@]13CC4[C@@H](N4CC4CC4)[C@]1(O)CC[C@@H](N1C(=O)c4ccc(CI)cc4C1=O)[C@@H]3O2 |
| InChI | InChI=1S/C29H29IN2O5/c1-14-2-7-21(33)23-22(14)28-11-20-24(31(20)13-15-3-4-15)29(28,36)9-8-19(25(28)37-23)32-26(34)17-6-5-16(12-30)10-18(17)27(32)35/h2,5-7,10,15,19-20,24-25,33,36H,3-4,8-9,11-13H2,1H3/t19-,20?,24-,25+,28+,29-,31?/m1/s1 |
| InChIKey | YPSHKUBRXINFSW-UGSYDBDCSA-N |
| XLogP | 3.69 |
| TPSA | 90.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|