C24H34O2 — CID 89253626
[4-(4-methylcyclohexyl)-1-(4-methylphenyl)cyclohexyl]methyl prop-2-enoate (PubChem CID 89253626) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is [4-(4-methylcyclohexyl)-1-(4-methylphenyl)cyclohexyl]methyl prop-2-enoate.
| Compound Name | [4-(4-methylcyclohexyl)-1-(4-methylphenyl)cyclohexyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 89253626 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | [4-(4-methylcyclohexyl)-1-(4-methylphenyl)cyclohexyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1(c2ccc(C)cc2)CCC(C2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C24H34O2/c1-4-23(25)26-17-24(22-11-7-19(3)8-12-22)15-13-21(14-16-24)20-9-5-18(2)6-10-20/h4,7-8,11-12,18,20-21H,1,5-6,9-10,13-17H2,2-3H3 |
| InChIKey | RRJCKPDPCRPRLY-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|