C25H34O3 — CID 89253649
[2-[4-methyl-1-[4-(4-methylphenyl)cyclohexyl]cyclohexyl]-2-oxoethyl] prop-2-enoate (PubChem CID 89253649) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is [2-[4-methyl-1-[4-(4-methylphenyl)cyclohexyl]cyclohexyl]-2-oxoethyl] prop-2-enoate.
| Compound Name | [2-[4-methyl-1-[4-(4-methylphenyl)cyclohexyl]cyclohexyl]-2-oxoethyl] prop-2-enoate |
|---|---|
| PubChem CID | 89253649 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | [2-[4-methyl-1-[4-(4-methylphenyl)cyclohexyl]cyclohexyl]-2-oxoethyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(=O)C1(C2CCC(c3ccc(C)cc3)CC2)CCC(C)CC1 |
| InChI | InChI=1S/C25H34O3/c1-4-24(27)28-17-23(26)25(15-13-19(3)14-16-25)22-11-9-21(10-12-22)20-7-5-18(2)6-8-20/h4-8,19,21-22H,1,9-17H2,2-3H3 |
| InChIKey | IMASZSKRHKGCBQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|