C22H33NO5S — CID 89254869
(4-nitrophenyl) 6-[(2S,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]sulfanylhexanoate (PubChem CID 89254869) has the molecular formula C22H33NO5S and a molecular weight of 423.58 g/mol. Its IUPAC name is (4-nitrophenyl) 6-[(2S,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]sulfanylhexanoate.
| Compound Name | (4-nitrophenyl) 6-[(2S,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]sulfanylhexanoate |
|---|---|
| PubChem CID | 89254869 |
| Molecular Formula | C22H33NO5S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | (4-nitrophenyl) 6-[(2S,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]sulfanylhexanoate |
| SMILES | CCC1O[C@@H](SCCCCCC(=O)Oc2ccc([N+](=O)[O-])cc2)C(C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C22H33NO5S/c1-5-20-16(3)15(2)17(4)22(28-20)29-14-8-6-7-9-21(24)27-19-12-10-18(11-13-19)23(25)26/h10-13,15-17,20,22H,5-9,14H2,1-4H3/t15-,16-,17?,20?,22-/m0/s1 |
| InChIKey | DCSCTXZZUQREKX-WPRAHNCISA-N |
| XLogP | 5.84 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|