C22H26F3NO6 — CID 89260919
(2S,3R,5S,6R)-2-[4-amino-3-[[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 89260919) has the molecular formula C22H26F3NO6 and a molecular weight of 457.45 g/mol. Its IUPAC name is (2S,3R,5S,6R)-2-[4-amino-3-[[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,5S,6R)-2-[4-amino-3-[[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 89260919 |
| Molecular Formula | C22H26F3NO6 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | (2S,3R,5S,6R)-2-[4-amino-3-[[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC(O)(c1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)C(O)[C@H]3O)ccc2N)cc1)C(F)(F)F |
| InChI | InChI=1S/C22H26F3NO6/c1-21(31,22(23,24)25)14-5-2-11(3-6-14)8-13-9-12(4-7-15(13)26)20-19(30)18(29)17(28)16(10-27)32-20/h2-7,9,16-20,27-31H,8,10,26H2,1H3/t16-,17-,18?,19-,20+,21?/m1/s1 |
| InChIKey | OSPWGNBBZJFXJM-FHNQHNFYSA-N |
| XLogP | 1.14 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|