C23H30N2O4S2 — CID 89267405
2-[5-(dithiolan-3-yl)pentylamino]-1-(3-nitro-4-phenylmethoxyphenyl)ethanol (PubChem CID 89267405) has the molecular formula C23H30N2O4S2 and a molecular weight of 462.64 g/mol. Its IUPAC name is 2-[5-(dithiolan-3-yl)pentylamino]-1-(3-nitro-4-phenylmethoxyphenyl)ethanol.
| Compound Name | 2-[5-(dithiolan-3-yl)pentylamino]-1-(3-nitro-4-phenylmethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 89267405 |
| Molecular Formula | C23H30N2O4S2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2-[5-(dithiolan-3-yl)pentylamino]-1-(3-nitro-4-phenylmethoxyphenyl)ethanol |
| SMILES | O=[N+]([O-])c1cc(C(O)CNCCCCCC2CCSS2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C23H30N2O4S2/c26-22(16-24-13-6-2-5-9-20-12-14-30-31-20)19-10-11-23(21(15-19)25(27)28)29-17-18-7-3-1-4-8-18/h1,3-4,7-8,10-11,15,20,22,24,26H,2,5-6,9,12-14,16-17H2 |
| InChIKey | DIAPSWIOLVZJOP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|