C15H29N3 — CID 89270665
3-[4-(aminomethyl)hept-1-en-2-yl]-N,5-dimethyl-1,2,3,4-tetrahydropyridin-2-amine (PubChem CID 89270665) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is 3-[4-(aminomethyl)hept-1-en-2-yl]-N,5-dimethyl-1,2,3,4-tetrahydropyridin-2-amine.
| Compound Name | 3-[4-(aminomethyl)hept-1-en-2-yl]-N,5-dimethyl-1,2,3,4-tetrahydropyridin-2-amine |
|---|---|
| PubChem CID | 89270665 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | 3-[4-(aminomethyl)hept-1-en-2-yl]-N,5-dimethyl-1,2,3,4-tetrahydropyridin-2-amine |
| SMILES | C=C(CC(CN)CCC)C1CC(C)=CNC1NC |
| InChI | InChI=1S/C15H29N3/c1-5-6-13(9-16)8-12(3)14-7-11(2)10-18-15(14)17-4/h10,13-15,17-18H,3,5-9,16H2,1-2,4H3 |
| InChIKey | PGTVKHBJUOVTNU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|