C27H20N4O4S — CID 89274066
6-(2-ethyl-6-methylphenyl)-13-[(4-methyl-1,3-thiazol-2-yl)amino]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 89274066) has the molecular formula C27H20N4O4S and a molecular weight of 496.55 g/mol. Its IUPAC name is 6-(2-ethyl-6-methylphenyl)-13-[(4-methyl-1,3-thiazol-2-yl)amino]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6-(2-ethyl-6-methylphenyl)-13-[(4-methyl-1,3-thiazol-2-yl)amino]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 89274066 |
| Molecular Formula | C27H20N4O4S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 6-(2-ethyl-6-methylphenyl)-13-[(4-methyl-1,3-thiazol-2-yl)amino]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CCc1cccc(C)c1N1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(Nc1nc(C)cs1)C3=O |
| InChI | InChI=1S/C27H20N4O4S/c1-4-15-7-5-6-13(2)22(15)30-23(32)16-8-10-18-21-19(11-9-17(20(16)21)24(30)33)26(35)31(25(18)34)29-27-28-14(3)12-36-27/h5-12H,4H2,1-3H3,(H,28,29) |
| InChIKey | JQSZPACDBYCMMF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|