C28H32F2 — CID 89277398
2-fluoro-4-[(2R,4Z,6Z)-2-fluoronona-4,6,8-trienyl]-1-[2-[4-[(E)-pent-3-enyl]phenyl]ethyl]benzene (PubChem CID 89277398) has the molecular formula C28H32F2 and a molecular weight of 406.56 g/mol. Its IUPAC name is 2-fluoro-4-[(2R,4Z,6Z)-2-fluoronona-4,6,8-trienyl]-1-[2-[4-[(E)-pent-3-enyl]phenyl]ethyl]benzene.
| Compound Name | 2-fluoro-4-[(2R,4Z,6Z)-2-fluoronona-4,6,8-trienyl]-1-[2-[4-[(E)-pent-3-enyl]phenyl]ethyl]benzene |
|---|---|
| PubChem CID | 89277398 |
| Molecular Formula | C28H32F2 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 2-fluoro-4-[(2R,4Z,6Z)-2-fluoronona-4,6,8-trienyl]-1-[2-[4-[(E)-pent-3-enyl]phenyl]ethyl]benzene |
| SMILES | C=C/C=C\C=C/C[C@@H](F)Cc1ccc(CCc2ccc(CC/C=C/C)cc2)c(F)c1 |
| InChI | InChI=1S/C28H32F2/c1-3-5-7-8-10-12-27(29)21-25-18-20-26(28(30)22-25)19-17-24-15-13-23(14-16-24)11-9-6-4-2/h3-8,10,13-16,18,20,22,27H,1,9,11-12,17,19,21H2,2H3/b6-4+,7-5-,10-8-/t27-/m1/s1 |
| InChIKey | CZTPGJJFKLNTJL-IZLJOKPOSA-N |
| XLogP | 7.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|