C21H17ClF3IN4O — CID 89282226
1-[[5-(2-chloro-5-iodophenyl)-1,2,4-oxadiazol-3-yl]methyl]-2-propyl-4-(trifluoromethyl)indol-5-amine (PubChem CID 89282226) has the molecular formula C21H17ClF3IN4O and a molecular weight of 560.75 g/mol. Its IUPAC name is 1-[[5-(2-chloro-5-iodophenyl)-1,2,4-oxadiazol-3-yl]methyl]-2-propyl-4-(trifluoromethyl)indol-5-amine.
| Compound Name | 1-[[5-(2-chloro-5-iodophenyl)-1,2,4-oxadiazol-3-yl]methyl]-2-propyl-4-(trifluoromethyl)indol-5-amine |
|---|---|
| PubChem CID | 89282226 |
| Molecular Formula | C21H17ClF3IN4O |
| Molecular Weight | 560.75 g/mol |
| Exact Mass | 560.01 |
| IUPAC Name | 1-[[5-(2-chloro-5-iodophenyl)-1,2,4-oxadiazol-3-yl]methyl]-2-propyl-4-(trifluoromethyl)indol-5-amine |
| SMILES | CCCc1cc2c(C(F)(F)F)c(N)ccc2n1Cc1noc(-c2cc(I)ccc2Cl)n1 |
| InChI | InChI=1S/C21H17ClF3IN4O/c1-2-3-12-9-14-17(7-6-16(27)19(14)21(23,24)25)30(12)10-18-28-20(31-29-18)13-8-11(26)4-5-15(13)22/h4-9H,2-3,10,27H2,1H3 |
| InChIKey | CBTSAHZPGKDIHT-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.75 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|