C25H35N3O5 — CID 89285479
tert-butyl N-[(2R)-1-[[(1E,3Z)-1-amino-5-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]hexa-1,3,5-trien-2-yl]amino]-1-oxobutan-2-yl]carbamate (PubChem CID 89285479) has the molecular formula C25H35N3O5 and a molecular weight of 457.57 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[[(1E,3Z)-1-amino-5-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]hexa-1,3,5-trien-2-yl]amino]-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[[(1E,3Z)-1-amino-5-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]hexa-1,3,5-trien-2-yl]amino]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 89285479 |
| Molecular Formula | C25H35N3O5 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | tert-butyl N-[(2R)-1-[[(1E,3Z)-1-amino-5-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]hexa-1,3,5-trien-2-yl]amino]-1-oxobutan-2-yl]carbamate |
| SMILES | C=C(/C=C\C(=C/N)NC(=O)[C@@H](CC)NC(=O)OC(C)(C)C)Oc1ccc2c(c1)C(C)(C)OC2 |
| InChI | InChI=1S/C25H35N3O5/c1-8-21(28-23(30)33-24(3,4)5)22(29)27-18(14-26)11-9-16(2)32-19-12-10-17-15-31-25(6,7)20(17)13-19/h9-14,21H,2,8,15,26H2,1,3-7H3,(H,27,29)(H,28,30)/b11-9-,18-14-/t21-/m1/s1 |
| InChIKey | TUQGRCAIUASMQD-NNTHNIEJSA-N |
| XLogP | 4.12 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|