C21H24ClF2N5O — CID 89290913
N-(4-chlorophenyl)-4-[N'-(2,4-difluorophenyl)carbamimidoyl]-3-propan-2-ylpiperazine-1-carboxamide (PubChem CID 89290913) has the molecular formula C21H24ClF2N5O and a molecular weight of 435.91 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[N'-(2,4-difluorophenyl)carbamimidoyl]-3-propan-2-ylpiperazine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-[N'-(2,4-difluorophenyl)carbamimidoyl]-3-propan-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 89290913 |
| Molecular Formula | C21H24ClF2N5O |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-(4-chlorophenyl)-4-[N'-(2,4-difluorophenyl)carbamimidoyl]-3-propan-2-ylpiperazine-1-carboxamide |
| SMILES | CC(C)C1CN(C(=O)Nc2ccc(Cl)cc2)CCN1/C(N)=N/c1ccc(F)cc1F |
| InChI | InChI=1S/C21H24ClF2N5O/c1-13(2)19-12-28(21(30)26-16-6-3-14(22)4-7-16)9-10-29(19)20(25)27-18-8-5-15(23)11-17(18)24/h3-8,11,13,19H,9-10,12H2,1-2H3,(H2,25,27)(H,26,30) |
| InChIKey | AXPOQYHHJPLNLD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|