C26H28ClN7O2 — CID 59690148
N-(4-chlorophenyl)-4-[(NE)-N'-cyano-N-(1-hydroxy-2-methylquinolin-5-ylidene)carbamimidoyl]-3-propan-2-ylpiperazine-1-carboxamide (PubChem CID 59690148) has the molecular formula C26H28ClN7O2 and a molecular weight of 506.01 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[(NE)-N'-cyano-N-(1-hydroxy-2-methylquinolin-5-ylidene)carbamimidoyl]-3-propan-2-ylpiperazine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-[(NE)-N'-cyano-N-(1-hydroxy-2-methylquinolin-5-ylidene)carbamimidoyl]-3-propan-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 59690148 |
| Molecular Formula | C26H28ClN7O2 |
| Molecular Weight | 506.01 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | N-(4-chlorophenyl)-4-[(NE)-N'-cyano-N-(1-hydroxy-2-methylquinolin-5-ylidene)carbamimidoyl]-3-propan-2-ylpiperazine-1-carboxamide |
| SMILES | Cc1ccc2/c(=N/C(=N/C#N)N3CCN(C(=O)Nc4ccc(Cl)cc4)CC3C(C)C)cccc-2n1O |
| InChI | InChI=1S/C26H28ClN7O2/c1-17(2)24-15-32(26(35)30-20-10-8-19(27)9-11-20)13-14-33(24)25(29-16-28)31-22-5-4-6-23-21(22)12-7-18(3)34(23)36/h4-12,17,24,36H,13-15H2,1-3H3,(H,30,35)/b29-25-,31-22+ |
| InChIKey | DIQWSCBMKXLXNR-OMUTUGNLSA-N |
| XLogP | 4.40 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.01 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|