C22H25ClFN7O — CID 59689960
N-(4-chlorophenyl)-4-[N-cyano-N'-[(2-fluoro-3-pyridinyl)methyl]carbamimidoyl]-3-propan-2-ylpiperazine-1-carboxamide (PubChem CID 59689960) has the molecular formula C22H25ClFN7O and a molecular weight of 457.94 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[N-cyano-N'-[(2-fluoro-3-pyridinyl)methyl]carbamimidoyl]-3-propan-2-ylpiperazine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-[N-cyano-N'-[(2-fluoro-3-pyridinyl)methyl]carbamimidoyl]-3-propan-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 59689960 |
| Molecular Formula | C22H25ClFN7O |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | N-(4-chlorophenyl)-4-[N-cyano-N'-[(2-fluoro-3-pyridinyl)methyl]carbamimidoyl]-3-propan-2-ylpiperazine-1-carboxamide |
| SMILES | CC(C)C1CN(C(=O)Nc2ccc(Cl)cc2)CCN1/C(=N/Cc1cccnc1F)NC#N |
| InChI | InChI=1S/C22H25ClFN7O/c1-15(2)19-13-30(22(32)29-18-7-5-17(23)6-8-18)10-11-31(19)21(28-14-25)27-12-16-4-3-9-26-20(16)24/h3-9,15,19H,10-13H2,1-2H3,(H,27,28)(H,29,32) |
| InChIKey | IHRMQBZVMNOPDF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 96.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|