C25H27F3N4O — CID 89295985
N-[4-amino-3-(trifluoromethyl)phenyl]-2-methyl-2-[[2-(N-methylanilino)phenyl]methylamino]propanamide (PubChem CID 89295985) has the molecular formula C25H27F3N4O and a molecular weight of 456.51 g/mol. Its IUPAC name is N-[4-amino-3-(trifluoromethyl)phenyl]-2-methyl-2-[[2-(N-methylanilino)phenyl]methylamino]propanamide.
| Compound Name | N-[4-amino-3-(trifluoromethyl)phenyl]-2-methyl-2-[[2-(N-methylanilino)phenyl]methylamino]propanamide |
|---|---|
| PubChem CID | 89295985 |
| Molecular Formula | C25H27F3N4O |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | N-[4-amino-3-(trifluoromethyl)phenyl]-2-methyl-2-[[2-(N-methylanilino)phenyl]methylamino]propanamide |
| SMILES | CN(c1ccccc1)c1ccccc1CNC(C)(C)C(=O)Nc1ccc(N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H27F3N4O/c1-24(2,23(33)31-18-13-14-21(29)20(15-18)25(26,27)28)30-16-17-9-7-8-12-22(17)32(3)19-10-5-4-6-11-19/h4-15,30H,16,29H2,1-3H3,(H,31,33) |
| InChIKey | XSISTUYWEIAVJF-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|