C17H23FN8O — CID 89297543
2-[4-(cyclohexylmethylamino)-6-(3-fluoro-4-hydroxyanilino)-1,3,5-triazin-2-yl]guanidine (PubChem CID 89297543) has the molecular formula C17H23FN8O and a molecular weight of 374.42 g/mol. Its IUPAC name is 2-[4-(cyclohexylmethylamino)-6-(3-fluoro-4-hydroxyanilino)-1,3,5-triazin-2-yl]guanidine.
| Compound Name | 2-[4-(cyclohexylmethylamino)-6-(3-fluoro-4-hydroxyanilino)-1,3,5-triazin-2-yl]guanidine |
|---|---|
| PubChem CID | 89297543 |
| Molecular Formula | C17H23FN8O |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-[4-(cyclohexylmethylamino)-6-(3-fluoro-4-hydroxyanilino)-1,3,5-triazin-2-yl]guanidine |
| SMILES | NC(N)=Nc1nc(NCC2CCCCC2)nc(Nc2ccc(O)c(F)c2)n1 |
| InChI | InChI=1S/C17H23FN8O/c18-12-8-11(6-7-13(12)27)22-16-24-15(25-17(26-16)23-14(19)20)21-9-10-4-2-1-3-5-10/h6-8,10,27H,1-5,9H2,(H6,19,20,21,22,23,24,25,26) |
| InChIKey | PXFBJTQJTXCVQR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 147.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|