C11H17N — CID 89304043
(3Z)-3-[(2Z)-2-methylpenta-2,4-dienylidene]piperidine (PubChem CID 89304043) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (3Z)-3-[(2Z)-2-methylpenta-2,4-dienylidene]piperidine.
| Compound Name | (3Z)-3-[(2Z)-2-methylpenta-2,4-dienylidene]piperidine |
|---|---|
| PubChem CID | 89304043 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (3Z)-3-[(2Z)-2-methylpenta-2,4-dienylidene]piperidine |
| SMILES | C=C/C=C(C)\C=C1\CCCNC1 |
| InChI | InChI=1S/C11H17N/c1-3-5-10(2)8-11-6-4-7-12-9-11/h3,5,8,12H,1,4,6-7,9H2,2H3/b10-5-,11-8- |
| InChIKey | ICXBLLCTKIKHAW-ZCBRBLLVSA-N |
| XLogP | 2.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|