C13H14F2O5S — CID 89309614
2,2-difluoro-3-(4-prop-1-en-2-ylbenzoyl)oxypropane-1-sulfonic acid (PubChem CID 89309614) has the molecular formula C13H14F2O5S and a molecular weight of 320.31 g/mol. Its IUPAC name is 2,2-difluoro-3-(4-prop-1-en-2-ylbenzoyl)oxypropane-1-sulfonic acid.
| Compound Name | 2,2-difluoro-3-(4-prop-1-en-2-ylbenzoyl)oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 89309614 |
| Molecular Formula | C13H14F2O5S |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2,2-difluoro-3-(4-prop-1-en-2-ylbenzoyl)oxypropane-1-sulfonic acid |
| SMILES | C=C(C)c1ccc(C(=O)OCC(F)(F)CS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C13H14F2O5S/c1-9(2)10-3-5-11(6-4-10)12(16)20-7-13(14,15)8-21(17,18)19/h3-6H,1,7-8H2,2H3,(H,17,18,19) |
| InChIKey | BVFOVCRMPZBWHU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|