C22H17F6N3O — CID 89310652
1-benzyl-3-[[3-(trifluoromethyl)-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]methyl]urea (PubChem CID 89310652) has the molecular formula C22H17F6N3O and a molecular weight of 453.39 g/mol. Its IUPAC name is 1-benzyl-3-[[3-(trifluoromethyl)-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]methyl]urea.
| Compound Name | 1-benzyl-3-[[3-(trifluoromethyl)-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 89310652 |
| Molecular Formula | C22H17F6N3O |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 1-benzyl-3-[[3-(trifluoromethyl)-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]methyl]urea |
| SMILES | O=C(NCc1ccccc1)NCc1nccc(-c2ccc(C(F)(F)F)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C22H17F6N3O/c23-21(24,25)16-8-6-15(7-9-16)17-10-11-29-18(19(17)22(26,27)28)13-31-20(32)30-12-14-4-2-1-3-5-14/h1-11H,12-13H2,(H2,30,31,32) |
| InChIKey | BOEHQILNOZEPIF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |