C8H10N4O3S2 — CID 89311250
3-[amino-[(methylideneamino)carbamothioyl]amino]benzenesulfonic acid (PubChem CID 89311250) has the molecular formula C8H10N4O3S2 and a molecular weight of 274.33 g/mol. Its IUPAC name is 3-[amino-[(methylideneamino)carbamothioyl]amino]benzenesulfonic acid.
| Compound Name | 3-[amino-[(methylideneamino)carbamothioyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 89311250 |
| Molecular Formula | C8H10N4O3S2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 3-[amino-[(methylideneamino)carbamothioyl]amino]benzenesulfonic acid |
| SMILES | C=NNC(=S)N(N)c1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C8H10N4O3S2/c1-10-11-8(16)12(9)6-3-2-4-7(5-6)17(13,14)15/h2-5H,1,9H2,(H,11,16)(H,13,14,15) |
| InChIKey | TVYWSVXJYGFZEV-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|