C23H20N2O4S — CID 89318933
(5Z)-5-[[1-[[4-(2-hydroxypropanoyl)phenyl]methyl]-2-methylindol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 89318933) has the molecular formula C23H20N2O4S and a molecular weight of 420.49 g/mol. Its IUPAC name is (5Z)-5-[[1-[[4-(2-hydroxypropanoyl)phenyl]methyl]-2-methylindol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-[[4-(2-hydroxypropanoyl)phenyl]methyl]-2-methylindol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 89318933 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | (5Z)-5-[[1-[[4-(2-hydroxypropanoyl)phenyl]methyl]-2-methylindol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1c(/C=C2\SC(=O)NC2=O)c2ccccc2n1Cc1ccc(C(=O)C(C)O)cc1 |
| InChI | InChI=1S/C23H20N2O4S/c1-13-18(11-20-22(28)24-23(29)30-20)17-5-3-4-6-19(17)25(13)12-15-7-9-16(10-8-15)21(27)14(2)26/h3-11,14,26H,12H2,1-2H3,(H,24,28,29)/b20-11- |
| InChIKey | GTSHOBGVLIXCKG-JAIQZWGSSA-N |
| XLogP | 3.89 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|