C19H22IN3 — CID 89324757
3-hexyl-7-(iodomethyl)-5-phenylpyrazolo[1,5-a]pyrimidine (PubChem CID 89324757) has the molecular formula C19H22IN3 and a molecular weight of 419.31 g/mol. Its IUPAC name is 3-hexyl-7-(iodomethyl)-5-phenylpyrazolo[1,5-a]pyrimidine.
| Compound Name | 3-hexyl-7-(iodomethyl)-5-phenylpyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 89324757 |
| Molecular Formula | C19H22IN3 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 3-hexyl-7-(iodomethyl)-5-phenylpyrazolo[1,5-a]pyrimidine |
| SMILES | CCCCCCc1cnn2c(CI)cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C19H22IN3/c1-2-3-4-6-11-16-14-21-23-17(13-20)12-18(22-19(16)23)15-9-7-5-8-10-15/h5,7-10,12,14H,2-4,6,11,13H2,1H3 |
| InChIKey | ZETQFGBAEWQKJH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|