C19H27ClO2 — CID 89325698
(4aR,8S,8aS)-7-acetyl-3-chloro-8-ethyl-4a-methyl-3,4,4b,5,6,7,8,8a,9,10-decahydrophenanthren-2-one (PubChem CID 89325698) has the molecular formula C19H27ClO2 and a molecular weight of 322.88 g/mol. Its IUPAC name is (4aR,8S,8aS)-7-acetyl-3-chloro-8-ethyl-4a-methyl-3,4,4b,5,6,7,8,8a,9,10-decahydrophenanthren-2-one.
| Compound Name | (4aR,8S,8aS)-7-acetyl-3-chloro-8-ethyl-4a-methyl-3,4,4b,5,6,7,8,8a,9,10-decahydrophenanthren-2-one |
|---|---|
| PubChem CID | 89325698 |
| Molecular Formula | C19H27ClO2 |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (4aR,8S,8aS)-7-acetyl-3-chloro-8-ethyl-4a-methyl-3,4,4b,5,6,7,8,8a,9,10-decahydrophenanthren-2-one |
| SMILES | CC[C@@H]1C(C(C)=O)CCC2[C@H]1CCC1=CC(=O)C(Cl)C[C@@]12C |
| InChI | InChI=1S/C19H27ClO2/c1-4-13-14(11(2)21)7-8-16-15(13)6-5-12-9-18(22)17(20)10-19(12,16)3/h9,13-17H,4-8,10H2,1-3H3/t13-,14?,15+,16?,17?,19+/m1/s1 |
| InChIKey | GTCMSIIOPRQSIF-AVNQCFNDSA-N |
| XLogP | 4.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|