C17H17F6NO6 — CID 89330866
(2,2,2-trifluoroacetyl) 4-[2-methoxy-4-[1-[(2,2,2-trifluoroacetyl)amino]ethyl]phenoxy]butanoate (PubChem CID 89330866) has the molecular formula C17H17F6NO6 and a molecular weight of 445.31 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 4-[2-methoxy-4-[1-[(2,2,2-trifluoroacetyl)amino]ethyl]phenoxy]butanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 4-[2-methoxy-4-[1-[(2,2,2-trifluoroacetyl)amino]ethyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 89330866 |
| Molecular Formula | C17H17F6NO6 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 4-[2-methoxy-4-[1-[(2,2,2-trifluoroacetyl)amino]ethyl]phenoxy]butanoate |
| SMILES | COc1cc(C(C)NC(=O)C(F)(F)F)ccc1OCCCC(=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H17F6NO6/c1-9(24-14(26)16(18,19)20)10-5-6-11(12(8-10)28-2)29-7-3-4-13(25)30-15(27)17(21,22)23/h5-6,8-9H,3-4,7H2,1-2H3,(H,24,26) |
| InChIKey | YJXXYAPHXHHCKC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|