C26H35N5O7 — CID 89331939
[N-[4-(cyclopropylcarbamoyl)-1,3-dimethylpyrrole-2-carboximidoyl]-5-(ethylcarbamoyl)-2-methylanilino]oxymethoxymethyl 2-hydroxypropanoate (PubChem CID 89331939) has the molecular formula C26H35N5O7 and a molecular weight of 529.59 g/mol. Its IUPAC name is [N-[4-(cyclopropylcarbamoyl)-1,3-dimethylpyrrole-2-carboximidoyl]-5-(ethylcarbamoyl)-2-methylanilino]oxymethoxymethyl 2-hydroxypropanoate.
| Compound Name | [N-[4-(cyclopropylcarbamoyl)-1,3-dimethylpyrrole-2-carboximidoyl]-5-(ethylcarbamoyl)-2-methylanilino]oxymethoxymethyl 2-hydroxypropanoate |
|---|---|
| PubChem CID | 89331939 |
| Molecular Formula | C26H35N5O7 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | [N-[4-(cyclopropylcarbamoyl)-1,3-dimethylpyrrole-2-carboximidoyl]-5-(ethylcarbamoyl)-2-methylanilino]oxymethoxymethyl 2-hydroxypropanoate |
| SMILES | [H]/N=C(\c1c(C)c(C(=O)NC2CC2)cn1C)N(OCOCOC(=O)C(C)O)c1cc(C(=O)NCC)ccc1C |
| InChI | InChI=1S/C26H35N5O7/c1-6-28-24(33)18-8-7-15(2)21(11-18)31(38-14-36-13-37-26(35)17(4)32)23(27)22-16(3)20(12-30(22)5)25(34)29-19-9-10-19/h7-8,11-12,17,19,27,32H,6,9-10,13-14H2,1-5H3,(H,28,33)(H,29,34)/b27-23+ |
| InChIKey | FCZHPCRZTLCMKH-SLEBQGDGSA-N |
| XLogP | 1.90 |
| TPSA | 155.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|