C26H36N6O6 — CID 89332168
[[4-(ethylcarbamoyl)-1,3-dimethylpyrrole-2-carboximidoyl]-[2-methyl-5-(propylcarbamoyl)phenyl]carbamoyl]oxymethyl 2-aminopropanoate (PubChem CID 89332168) has the molecular formula C26H36N6O6 and a molecular weight of 528.61 g/mol. Its IUPAC name is [[4-(ethylcarbamoyl)-1,3-dimethylpyrrole-2-carboximidoyl]-[2-methyl-5-(propylcarbamoyl)phenyl]carbamoyl]oxymethyl 2-aminopropanoate.
| Compound Name | [[4-(ethylcarbamoyl)-1,3-dimethylpyrrole-2-carboximidoyl]-[2-methyl-5-(propylcarbamoyl)phenyl]carbamoyl]oxymethyl 2-aminopropanoate |
|---|---|
| PubChem CID | 89332168 |
| Molecular Formula | C26H36N6O6 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | [[4-(ethylcarbamoyl)-1,3-dimethylpyrrole-2-carboximidoyl]-[2-methyl-5-(propylcarbamoyl)phenyl]carbamoyl]oxymethyl 2-aminopropanoate |
| SMILES | [H]/N=C(\c1c(C)c(C(=O)NCC)cn1C)N(C(=O)OCOC(=O)C(C)N)c1cc(C(=O)NCCC)ccc1C |
| InChI | InChI=1S/C26H36N6O6/c1-7-11-30-23(33)18-10-9-15(3)20(12-18)32(26(36)38-14-37-25(35)17(5)27)22(28)21-16(4)19(13-31(21)6)24(34)29-8-2/h9-10,12-13,17,28H,7-8,11,14,27H2,1-6H3,(H,29,34)(H,30,33)/b28-22+ |
| InChIKey | DNECQXMSNOQWDU-XAYXJRQQSA-N |
| XLogP | 2.35 |
| TPSA | 168.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|