C26H36N6O6 — CID 89331999
[[5-[N'-[5-(ethylcarbamoyl)-2-methylphenyl]carbamimidoyl]-1,4-dimethylpyrrole-3-carbonyl]-propylcarbamoyl]oxymethyl 2-aminopropanoate (PubChem CID 89331999) has the molecular formula C26H36N6O6 and a molecular weight of 528.61 g/mol. Its IUPAC name is [[5-[N'-[5-(ethylcarbamoyl)-2-methylphenyl]carbamimidoyl]-1,4-dimethylpyrrole-3-carbonyl]-propylcarbamoyl]oxymethyl 2-aminopropanoate.
| Compound Name | [[5-[N'-[5-(ethylcarbamoyl)-2-methylphenyl]carbamimidoyl]-1,4-dimethylpyrrole-3-carbonyl]-propylcarbamoyl]oxymethyl 2-aminopropanoate |
|---|---|
| PubChem CID | 89331999 |
| Molecular Formula | C26H36N6O6 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | [[5-[N'-[5-(ethylcarbamoyl)-2-methylphenyl]carbamimidoyl]-1,4-dimethylpyrrole-3-carbonyl]-propylcarbamoyl]oxymethyl 2-aminopropanoate |
| SMILES | CCCN(C(=O)OCOC(=O)C(C)N)C(=O)c1cn(C)c(/C(N)=N/c2cc(C(=O)NCC)ccc2C)c1C |
| InChI | InChI=1S/C26H36N6O6/c1-7-11-32(26(36)38-14-37-25(35)17(5)27)24(34)19-13-31(6)21(16(19)4)22(28)30-20-12-18(10-9-15(20)3)23(33)29-8-2/h9-10,12-13,17H,7-8,11,14,27H2,1-6H3,(H2,28,30)(H,29,33) |
| InChIKey | PRXLXMRPWDTBNB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 171.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|