C26H33N7O6 — CID 143537238
[[5-[N-(aminomethylidene)-N'-[5-(ethylcarbamoyl)-2-methylphenyl]carbamimidoyl]-4-methyl-1H-pyrrole-3-carbonyl]-cyclopropylcarbamoyl]oxymethyl 2-aminopropanoate (PubChem CID 143537238) has the molecular formula C26H33N7O6 and a molecular weight of 539.59 g/mol. Its IUPAC name is [[5-[N-(aminomethylidene)-N'-[5-(ethylcarbamoyl)-2-methylphenyl]carbamimidoyl]-4-methyl-1H-pyrrole-3-carbonyl]-cyclopropylcarbamoyl]oxymethyl 2-aminopropanoate.
| Compound Name | [[5-[N-(aminomethylidene)-N'-[5-(ethylcarbamoyl)-2-methylphenyl]carbamimidoyl]-4-methyl-1H-pyrrole-3-carbonyl]-cyclopropylcarbamoyl]oxymethyl 2-aminopropanoate |
|---|---|
| PubChem CID | 143537238 |
| Molecular Formula | C26H33N7O6 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | [[5-[N-(aminomethylidene)-N'-[5-(ethylcarbamoyl)-2-methylphenyl]carbamimidoyl]-4-methyl-1H-pyrrole-3-carbonyl]-cyclopropylcarbamoyl]oxymethyl 2-aminopropanoate |
| SMILES | CCNC(=O)c1ccc(C)c(/N=C(\N=C\N)c2[nH]cc(C(=O)N(C(=O)OCOC(=O)C(C)N)C3CC3)c2C)c1 |
| InChI | InChI=1S/C26H33N7O6/c1-5-29-23(34)17-7-6-14(2)20(10-17)32-22(31-12-27)21-15(3)19(11-30-21)24(35)33(18-8-9-18)26(37)39-13-38-25(36)16(4)28/h6-7,10-12,16,18,30H,5,8-9,13,28H2,1-4H3,(H,29,34)(H2,27,31,32) |
| InChIKey | MFLRHRDEGXCQSZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 194.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|