C24H30N6O7 — CID 143537390
[[5-[N-(aminomethylidene)-N'-[5-(ethylcarbamoyl)-2-methylphenyl]carbamimidoyl]-4-methyl-1H-pyrrole-3-carbonyl]-ethylcarbamoyl]oxymethyl 2-hydroxyacetate (PubChem CID 143537390) has the molecular formula C24H30N6O7 and a molecular weight of 514.54 g/mol. Its IUPAC name is [[5-[N-(aminomethylidene)-N'-[5-(ethylcarbamoyl)-2-methylphenyl]carbamimidoyl]-4-methyl-1H-pyrrole-3-carbonyl]-ethylcarbamoyl]oxymethyl 2-hydroxyacetate.
| Compound Name | [[5-[N-(aminomethylidene)-N'-[5-(ethylcarbamoyl)-2-methylphenyl]carbamimidoyl]-4-methyl-1H-pyrrole-3-carbonyl]-ethylcarbamoyl]oxymethyl 2-hydroxyacetate |
|---|---|
| PubChem CID | 143537390 |
| Molecular Formula | C24H30N6O7 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | [[5-[N-(aminomethylidene)-N'-[5-(ethylcarbamoyl)-2-methylphenyl]carbamimidoyl]-4-methyl-1H-pyrrole-3-carbonyl]-ethylcarbamoyl]oxymethyl 2-hydroxyacetate |
| SMILES | CCNC(=O)c1ccc(C)c(/N=C(\N=C\N)c2[nH]cc(C(=O)N(CC)C(=O)OCOC(=O)CO)c2C)c1 |
| InChI | InChI=1S/C24H30N6O7/c1-5-26-22(33)16-8-7-14(3)18(9-16)29-21(28-12-25)20-15(4)17(10-27-20)23(34)30(6-2)24(35)37-13-36-19(32)11-31/h7-10,12,27,31H,5-6,11,13H2,1-4H3,(H,26,33)(H2,25,28,29) |
| InChIKey | UYQIOCSXWMYZAF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 188.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|