C21H27N5O4 — CID 136606938
ethyl-[4-methyl-5-[N'-[2-methyl-5-(propylcarbamoyl)phenyl]carbamimidoyl]-1H-pyrrole-3-carbonyl]carbamic acid (PubChem CID 136606938) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is ethyl-[4-methyl-5-[N'-[2-methyl-5-(propylcarbamoyl)phenyl]carbamimidoyl]-1H-pyrrole-3-carbonyl]carbamic acid.
| Compound Name | ethyl-[4-methyl-5-[N'-[2-methyl-5-(propylcarbamoyl)phenyl]carbamimidoyl]-1H-pyrrole-3-carbonyl]carbamic acid |
|---|---|
| PubChem CID | 136606938 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | ethyl-[4-methyl-5-[N'-[2-methyl-5-(propylcarbamoyl)phenyl]carbamimidoyl]-1H-pyrrole-3-carbonyl]carbamic acid |
| SMILES | CCCNC(=O)c1ccc(C)c(/N=C(\N)c2[nH]cc(C(=O)N(CC)C(=O)O)c2C)c1 |
| InChI | InChI=1S/C21H27N5O4/c1-5-9-23-19(27)14-8-7-12(3)16(10-14)25-18(22)17-13(4)15(11-24-17)20(28)26(6-2)21(29)30/h7-8,10-11,24H,5-6,9H2,1-4H3,(H2,22,25)(H,23,27)(H,29,30) |
| InChIKey | HPQYCWWKUDYFQN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 140.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|