C25H28N6O8 — CID 136606975
[[4-methyl-5-[N'-[2-methyl-5-(1,2-oxazol-3-ylcarbamoyl)phenyl]carbamimidoyl]-1H-pyrrole-3-carbonyl]-propylcarbamoyl]oxymethyl 2-hydroxyacetate (PubChem CID 136606975) has the molecular formula C25H28N6O8 and a molecular weight of 540.53 g/mol. Its IUPAC name is [[4-methyl-5-[N'-[2-methyl-5-(1,2-oxazol-3-ylcarbamoyl)phenyl]carbamimidoyl]-1H-pyrrole-3-carbonyl]-propylcarbamoyl]oxymethyl 2-hydroxyacetate.
| Compound Name | [[4-methyl-5-[N'-[2-methyl-5-(1,2-oxazol-3-ylcarbamoyl)phenyl]carbamimidoyl]-1H-pyrrole-3-carbonyl]-propylcarbamoyl]oxymethyl 2-hydroxyacetate |
|---|---|
| PubChem CID | 136606975 |
| Molecular Formula | C25H28N6O8 |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | [[4-methyl-5-[N'-[2-methyl-5-(1,2-oxazol-3-ylcarbamoyl)phenyl]carbamimidoyl]-1H-pyrrole-3-carbonyl]-propylcarbamoyl]oxymethyl 2-hydroxyacetate |
| SMILES | CCCN(C(=O)OCOC(=O)CO)C(=O)c1c[nH]c(/C(N)=N/c2cc(C(=O)Nc3ccon3)ccc2C)c1C |
| InChI | InChI=1S/C25H28N6O8/c1-4-8-31(25(36)38-13-37-20(33)12-32)24(35)17-11-27-21(15(17)3)22(26)28-18-10-16(6-5-14(18)2)23(34)29-19-7-9-39-30-19/h5-7,9-11,27,32H,4,8,12-13H2,1-3H3,(H2,26,28)(H,29,30,34) |
| InChIKey | AGMRKWIFZWSOPW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 202.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|