C27H31N7O9 — CID 89332039
4-[[ethyl-[4-methyl-1-(methylamino)-5-[N'-[2-methyl-5-(1,2-oxazol-3-ylcarbamoyl)phenyl]carbamimidoyl]pyrrole-3-carbonyl]carbamoyl]oxymethoxy]-4-oxobutanoic acid (PubChem CID 89332039) has the molecular formula C27H31N7O9 and a molecular weight of 597.59 g/mol. Its IUPAC name is 4-[[ethyl-[4-methyl-1-(methylamino)-5-[N'-[2-methyl-5-(1,2-oxazol-3-ylcarbamoyl)phenyl]carbamimidoyl]pyrrole-3-carbonyl]carbamoyl]oxymethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[[ethyl-[4-methyl-1-(methylamino)-5-[N'-[2-methyl-5-(1,2-oxazol-3-ylcarbamoyl)phenyl]carbamimidoyl]pyrrole-3-carbonyl]carbamoyl]oxymethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 89332039 |
| Molecular Formula | C27H31N7O9 |
| Molecular Weight | 597.59 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | 4-[[ethyl-[4-methyl-1-(methylamino)-5-[N'-[2-methyl-5-(1,2-oxazol-3-ylcarbamoyl)phenyl]carbamimidoyl]pyrrole-3-carbonyl]carbamoyl]oxymethoxy]-4-oxobutanoic acid |
| SMILES | CCN(C(=O)OCOC(=O)CCC(=O)O)C(=O)c1cn(NC)c(/C(N)=N/c2cc(C(=O)Nc3ccon3)ccc2C)c1C |
| InChI | InChI=1S/C27H31N7O9/c1-5-33(27(40)42-14-41-22(37)9-8-21(35)36)26(39)18-13-34(29-4)23(16(18)3)24(28)30-19-12-17(7-6-15(19)2)25(38)31-20-10-11-43-32-20/h6-7,10-13,29H,5,8-9,14H2,1-4H3,(H2,28,30)(H,35,36)(H,31,32,38) |
| InChIKey | FMFIQLQOFMVXLW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 220.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.59 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|