C25H29N5O8 — CID 136606985
(E)-4-[[ethyl-[5-[N'-[5-(ethylcarbamoyl)-2-methylphenyl]carbamimidoyl]-4-methyl-1H-pyrrole-3-carbonyl]carbamoyl]oxymethoxy]-4-oxobut-2-enoic acid (PubChem CID 136606985) has the molecular formula C25H29N5O8 and a molecular weight of 527.53 g/mol. Its IUPAC name is (E)-4-[[ethyl-[5-[N'-[5-(ethylcarbamoyl)-2-methylphenyl]carbamimidoyl]-4-methyl-1H-pyrrole-3-carbonyl]carbamoyl]oxymethoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[ethyl-[5-[N'-[5-(ethylcarbamoyl)-2-methylphenyl]carbamimidoyl]-4-methyl-1H-pyrrole-3-carbonyl]carbamoyl]oxymethoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 136606985 |
| Molecular Formula | C25H29N5O8 |
| Molecular Weight | 527.53 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | (E)-4-[[ethyl-[5-[N'-[5-(ethylcarbamoyl)-2-methylphenyl]carbamimidoyl]-4-methyl-1H-pyrrole-3-carbonyl]carbamoyl]oxymethoxy]-4-oxobut-2-enoic acid |
| SMILES | CCNC(=O)c1ccc(C)c(/N=C(\N)c2[nH]cc(C(=O)N(CC)C(=O)OCOC(=O)/C=C/C(=O)O)c2C)c1 |
| InChI | InChI=1S/C25H29N5O8/c1-5-27-23(34)16-8-7-14(3)18(11-16)29-22(26)21-15(4)17(12-28-21)24(35)30(6-2)25(36)38-13-37-20(33)10-9-19(31)32/h7-12,28H,5-6,13H2,1-4H3,(H2,26,29)(H,27,34)(H,31,32)/b10-9+ |
| InChIKey | CIIHFWHUMVMCHI-MDZDMXLPSA-N |
| XLogP | 2.16 |
| TPSA | 193.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|