C23H25N5O8 — CID 136606851
(E)-4-[[(5-carbamoyl-2-methylphenyl)-[4-(ethylcarbamoyl)-3-methyl-1H-pyrrole-2-carboximidoyl]carbamoyl]oxymethoxy]-4-oxobut-2-enoic acid (PubChem CID 136606851) has the molecular formula C23H25N5O8 and a molecular weight of 499.48 g/mol. Its IUPAC name is (E)-4-[[(5-carbamoyl-2-methylphenyl)-[4-(ethylcarbamoyl)-3-methyl-1H-pyrrole-2-carboximidoyl]carbamoyl]oxymethoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[(5-carbamoyl-2-methylphenyl)-[4-(ethylcarbamoyl)-3-methyl-1H-pyrrole-2-carboximidoyl]carbamoyl]oxymethoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 136606851 |
| Molecular Formula | C23H25N5O8 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | (E)-4-[[(5-carbamoyl-2-methylphenyl)-[4-(ethylcarbamoyl)-3-methyl-1H-pyrrole-2-carboximidoyl]carbamoyl]oxymethoxy]-4-oxobut-2-enoic acid |
| SMILES | [H]/N=C(\c1[nH]cc(C(=O)NCC)c1C)N(C(=O)OCOC(=O)/C=C/C(=O)O)c1cc(C(N)=O)ccc1C |
| InChI | InChI=1S/C23H25N5O8/c1-4-26-22(33)15-10-27-19(13(15)3)20(24)28(16-9-14(21(25)32)6-5-12(16)2)23(34)36-11-35-18(31)8-7-17(29)30/h5-10,24,27H,4,11H2,1-3H3,(H2,25,32)(H,26,33)(H,29,30)/b8-7+,24-20+ |
| InChIKey | ZRVBASIZMMEFDN-MBCWTMDCSA-N |
| XLogP | 1.59 |
| TPSA | 204.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|