C23H29N5O7 — CID 89332189
[(5-carbamoyl-2-methylphenyl)-[4-(ethylcarbamoyl)-1,3-dimethylpyrrole-2-carboximidoyl]carbamoyl]oxymethyl 2-hydroxypropanoate (PubChem CID 89332189) has the molecular formula C23H29N5O7 and a molecular weight of 487.51 g/mol. Its IUPAC name is [(5-carbamoyl-2-methylphenyl)-[4-(ethylcarbamoyl)-1,3-dimethylpyrrole-2-carboximidoyl]carbamoyl]oxymethyl 2-hydroxypropanoate.
| Compound Name | [(5-carbamoyl-2-methylphenyl)-[4-(ethylcarbamoyl)-1,3-dimethylpyrrole-2-carboximidoyl]carbamoyl]oxymethyl 2-hydroxypropanoate |
|---|---|
| PubChem CID | 89332189 |
| Molecular Formula | C23H29N5O7 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | [(5-carbamoyl-2-methylphenyl)-[4-(ethylcarbamoyl)-1,3-dimethylpyrrole-2-carboximidoyl]carbamoyl]oxymethyl 2-hydroxypropanoate |
| SMILES | [H]/N=C(\c1c(C)c(C(=O)NCC)cn1C)N(C(=O)OCOC(=O)C(C)O)c1cc(C(N)=O)ccc1C |
| InChI | InChI=1S/C23H29N5O7/c1-6-26-21(31)16-10-27(5)18(13(16)3)19(24)28(23(33)35-11-34-22(32)14(4)29)17-9-15(20(25)30)8-7-12(17)2/h7-10,14,24,29H,6,11H2,1-5H3,(H2,25,30)(H,26,31)/b24-19+ |
| InChIKey | XLTZUMKFNXMMLU-LYBHJNIJSA-N |
| XLogP | 1.34 |
| TPSA | 177.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|