C27H38N6O7 — CID 143537442
[[5-[(E)-N'-(1-aminoethyl)-N-[5-(ethylcarbamoyl)-2-methylphenyl]carbamimidoyl]-4-methyl-1H-pyrrole-3-carbonyl]-propylcarbamoyl]oxymethyl 2-hydroxypropanoate (PubChem CID 143537442) has the molecular formula C27H38N6O7 and a molecular weight of 558.64 g/mol. Its IUPAC name is [[5-[(E)-N'-(1-aminoethyl)-N-[5-(ethylcarbamoyl)-2-methylphenyl]carbamimidoyl]-4-methyl-1H-pyrrole-3-carbonyl]-propylcarbamoyl]oxymethyl 2-hydroxypropanoate.
| Compound Name | [[5-[(E)-N'-(1-aminoethyl)-N-[5-(ethylcarbamoyl)-2-methylphenyl]carbamimidoyl]-4-methyl-1H-pyrrole-3-carbonyl]-propylcarbamoyl]oxymethyl 2-hydroxypropanoate |
|---|---|
| PubChem CID | 143537442 |
| Molecular Formula | C27H38N6O7 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | [[5-[(E)-N'-(1-aminoethyl)-N-[5-(ethylcarbamoyl)-2-methylphenyl]carbamimidoyl]-4-methyl-1H-pyrrole-3-carbonyl]-propylcarbamoyl]oxymethyl 2-hydroxypropanoate |
| SMILES | CCCN(C(=O)OCOC(=O)C(C)O)C(=O)c1c[nH]c(/C(=N\C(C)N)Nc2cc(C(=O)NCC)ccc2C)c1C |
| InChI | InChI=1S/C27H38N6O7/c1-7-11-33(27(38)40-14-39-26(37)17(5)34)25(36)20-13-30-22(16(20)4)23(31-18(6)28)32-21-12-19(10-9-15(21)3)24(35)29-8-2/h9-10,12-13,17-18,30,34H,7-8,11,14,28H2,1-6H3,(H,29,35)(H,31,32) |
| InChIKey | PCLNOVPNTVDMQZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 188.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|