C27H38N7O7+ — CID 143537414
aminomethylidene-[C-[4-[ethyl-[(2-formamido-1-hydroxypropoxy)methoxycarbonyl]carbamoyl]-3-methyl-1H-pyrrol-2-yl]-N-[2-methyl-5-(propylcarbamoyl)phenyl]carbonimidoyl]azanium (PubChem CID 143537414) has the molecular formula C27H38N7O7+ and a molecular weight of 572.64 g/mol. Its IUPAC name is aminomethylidene-[C-[4-[ethyl-[(2-formamido-1-hydroxypropoxy)methoxycarbonyl]carbamoyl]-3-methyl-1H-pyrrol-2-yl]-N-[2-methyl-5-(propylcarbamoyl)phenyl]carbonimidoyl]azanium.
| Compound Name | aminomethylidene-[C-[4-[ethyl-[(2-formamido-1-hydroxypropoxy)methoxycarbonyl]carbamoyl]-3-methyl-1H-pyrrol-2-yl]-N-[2-methyl-5-(propylcarbamoyl)phenyl]carbonimidoyl]azanium |
|---|---|
| PubChem CID | 143537414 |
| Molecular Formula | C27H38N7O7+ |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | aminomethylidene-[C-[4-[ethyl-[(2-formamido-1-hydroxypropoxy)methoxycarbonyl]carbamoyl]-3-methyl-1H-pyrrol-2-yl]-N-[2-methyl-5-(propylcarbamoyl)phenyl]carbonimidoyl]azanium |
| SMILES | CCCNC(=O)c1ccc(C)c(/N=C(\[NH+]=C\N)c2[nH]cc(C(=O)N(CC)C(=O)OCOC(O)C(C)NC=O)c2C)c1 |
| InChI | InChI=1S/C27H37N7O7/c1-6-10-29-24(36)19-9-8-16(3)21(11-19)33-23(31-13-28)22-17(4)20(12-30-22)25(37)34(7-2)27(39)41-15-40-26(38)18(5)32-14-35/h8-9,11-14,18,26,30,38H,6-7,10,15H2,1-5H3,(H,29,36)(H,32,35)(H2,28,31,33)/p+1 |
| InChIKey | HDJDWTVZQHXGEH-UHFFFAOYSA-O |
| XLogP | -0.06 |
| TPSA | 202.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|