C28H34N6O8 — CID 143537535
(E)-4-[[[5-[N-(aminomethylidene)-N'-[2-methyl-5-(propylcarbamoyl)phenyl]carbamimidoyl]-4-methyl-1H-pyrrole-3-carbonyl]-propylcarbamoyl]oxymethoxy]-4-oxobut-2-enoic acid (PubChem CID 143537535) has the molecular formula C28H34N6O8 and a molecular weight of 582.61 g/mol. Its IUPAC name is (E)-4-[[[5-[N-(aminomethylidene)-N'-[2-methyl-5-(propylcarbamoyl)phenyl]carbamimidoyl]-4-methyl-1H-pyrrole-3-carbonyl]-propylcarbamoyl]oxymethoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[[5-[N-(aminomethylidene)-N'-[2-methyl-5-(propylcarbamoyl)phenyl]carbamimidoyl]-4-methyl-1H-pyrrole-3-carbonyl]-propylcarbamoyl]oxymethoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 143537535 |
| Molecular Formula | C28H34N6O8 |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 582.24 |
| IUPAC Name | (E)-4-[[[5-[N-(aminomethylidene)-N'-[2-methyl-5-(propylcarbamoyl)phenyl]carbamimidoyl]-4-methyl-1H-pyrrole-3-carbonyl]-propylcarbamoyl]oxymethoxy]-4-oxobut-2-enoic acid |
| SMILES | CCCNC(=O)c1ccc(C)c(/N=C(\N=C\N)c2[nH]cc(C(=O)N(CCC)C(=O)OCOC(=O)/C=C/C(=O)O)c2C)c1 |
| InChI | InChI=1S/C28H34N6O8/c1-5-11-30-26(38)19-8-7-17(3)21(13-19)33-25(32-15-29)24-18(4)20(14-31-24)27(39)34(12-6-2)28(40)42-16-41-23(37)10-9-22(35)36/h7-10,13-15,31H,5-6,11-12,16H2,1-4H3,(H,30,38)(H,35,36)(H2,29,32,33)/b10-9+ |
| InChIKey | VZJYFAVBQBTESY-MDZDMXLPSA-N |
| XLogP | 2.97 |
| TPSA | 205.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|