C37H30N2O2+2 — CID 89332541
(2E,4E)-5-[4-[1-(4-benzoylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]-2-methyl-1-phenylhepta-2,4,6-trien-1-one (PubChem CID 89332541) has the molecular formula C37H30N2O2+2 and a molecular weight of 534.66 g/mol. Its IUPAC name is (2E,4E)-5-[4-[1-(4-benzoylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]-2-methyl-1-phenylhepta-2,4,6-trien-1-one.
| Compound Name | (2E,4E)-5-[4-[1-(4-benzoylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]-2-methyl-1-phenylhepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 89332541 |
| Molecular Formula | C37H30N2O2+2 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | (2E,4E)-5-[4-[1-(4-benzoylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]-2-methyl-1-phenylhepta-2,4,6-trien-1-one |
| SMILES | C=C/C(=C\C=C(/C)C(=O)c1ccccc1)[n+]1ccc(-c2cc[n+](-c3ccc(C(=O)c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H30N2O2/c1-3-34(17-14-28(2)36(40)31-10-6-4-7-11-31)38-24-20-29(21-25-38)30-22-26-39(27-23-30)35-18-15-33(16-19-35)37(41)32-12-8-5-9-13-32/h3-27H,1H2,2H3/q+2/b28-14+,34-17+ |
| InChIKey | KCRIPJSHVDKSIF-BTXIUSRBSA-N |
| XLogP | 7.00 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|