C13H18ClIN2O2S — CID 89334298
(2S,5R)-1-[4-chloro-3-(iodomethyl)phenyl]sulfonyl-2,5-dimethylpiperazine (PubChem CID 89334298) has the molecular formula C13H18ClIN2O2S and a molecular weight of 428.72 g/mol. Its IUPAC name is (2S,5R)-1-[4-chloro-3-(iodomethyl)phenyl]sulfonyl-2,5-dimethylpiperazine.
| Compound Name | (2S,5R)-1-[4-chloro-3-(iodomethyl)phenyl]sulfonyl-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 89334298 |
| Molecular Formula | C13H18ClIN2O2S |
| Molecular Weight | 428.72 g/mol |
| Exact Mass | 427.98 |
| IUPAC Name | (2S,5R)-1-[4-chloro-3-(iodomethyl)phenyl]sulfonyl-2,5-dimethylpiperazine |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2ccc(Cl)c(CI)c2)[C@@H](C)CN1 |
| InChI | InChI=1S/C13H18ClIN2O2S/c1-9-8-17(10(2)7-16-9)20(18,19)12-3-4-13(14)11(5-12)6-15/h3-5,9-10,16H,6-8H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | BQWOMRKYNWVVFF-ZJUUUORDSA-N |
| XLogP | 2.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.72 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|