C23H40BO6S — CID 89335054
CID 89335054 (PubChem CID 89335054) has the molecular formula C23H40BO6S and a molecular weight of 457.45 g/mol.
| Compound Name | CID 89335054 |
|---|---|
| PubChem CID | 89335054 |
| Molecular Formula | C23H40BO6S |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | — |
| SMILES | [3H][B]SO[C@@H](CC(=O)O)C[C@@H]1CCC[C@H](C[C@@H]2CCO[C@@]3(C[C@H](C)CC[C@H]3C(C)C)O2)O1 |
| InChI | InChI=1S/C23H40BO6S/c1-15(2)21-8-7-16(3)14-23(21)27-10-9-19(29-23)11-17-5-4-6-18(28-17)12-20(30-31-24)13-22(25)26/h15-21,24H,4-14H2,1-3H3,(H,25,26)/t16-,17-,18+,19+,20-,21+,23+/m1/s1/i24T |
| InChIKey | LEVOANPPFIYNKX-AKXXIEAGSA-N |
| XLogP | 4.62 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|