C54H79BClO17S — CID 90753387
CID 90753387 (PubChem CID 90753387) has the molecular formula C54H79BClO17S and a molecular weight of 1080.55 g/mol.
| Compound Name | CID 90753387 |
|---|---|
| PubChem CID | 90753387 |
| Molecular Formula | C54H79BClO17S |
| Molecular Weight | 1080.55 g/mol |
| Exact Mass | 1079.49 |
| IUPAC Name | — |
| SMILES | [3H][B]SO[C@H](CC(=O)O[C@@H](C[C@@H]1CCOC2(C[C@H](C)CC[C@H]2C(C)C)O1)C(C)(C)COC(=O)CCl)CC(=O)O[C@H](C[C@@H]1CC(=CC(=O)OC)[C@H](OC(=O)CC)[C@](O)(C(C)(C)C=CC=O)O1)[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C54H79BClO17S/c1-11-45(58)70-50-38(25-46(59)64-10)24-40(72-54(50,63)52(8,9)21-15-22-57)26-43(36(5)65-32-37-16-13-12-14-17-37)68-47(60)28-41(73-74-55)29-48(61)69-44(51(6,7)33-66-49(62)31-56)27-39-20-23-67-53(71-39)30-35(4)18-19-42(53)34(2)3/h12-17,21-22,25,34-36,39-44,50,55,63H,11,18-20,23-24,26-33H2,1-10H3/t35-,36+,39+,40+,41+,42+,43-,44+,50+,53?,54-/m1/s1/i55T |
| InChIKey | QXQYLLJFQQHESF-BTDMNIMKSA-N |
| XLogP | 7.91 |
| TPSA | 214.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1080.55 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|