C27H52O4Si — CID 139249758
tert-butyl-dimethyl-[(3S)-1-[2-[(4R,8R,11S)-8-methyl-11-propan-2-yl-1,5-dioxaspiro[5.5]undecan-4-yl]ethoxy]hex-5-en-3-yl]oxysilane (PubChem CID 139249758) has the molecular formula C27H52O4Si and a molecular weight of 468.80 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3S)-1-[2-[(4R,8R,11S)-8-methyl-11-propan-2-yl-1,5-dioxaspiro[5.5]undecan-4-yl]ethoxy]hex-5-en-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3S)-1-[2-[(4R,8R,11S)-8-methyl-11-propan-2-yl-1,5-dioxaspiro[5.5]undecan-4-yl]ethoxy]hex-5-en-3-yl]oxysilane |
|---|---|
| PubChem CID | 139249758 |
| Molecular Formula | C27H52O4Si |
| Molecular Weight | 468.80 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | tert-butyl-dimethyl-[(3S)-1-[2-[(4R,8R,11S)-8-methyl-11-propan-2-yl-1,5-dioxaspiro[5.5]undecan-4-yl]ethoxy]hex-5-en-3-yl]oxysilane |
| SMILES | C=CC[C@@H](CCOCC[C@@H]1CCOC2(C[C@H](C)CC[C@H]2C(C)C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H52O4Si/c1-10-11-24(31-32(8,9)26(5,6)7)15-18-28-17-14-23-16-19-29-27(30-23)20-22(4)12-13-25(27)21(2)3/h10,21-25H,1,11-20H2,2-9H3/t22-,23-,24+,25+,27?/m1/s1 |
| InChIKey | KPNQTQLOZCQDMR-SUVJPPNLSA-N |
| XLogP | 7.34 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.80 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|