C10H14N2 — CID 89336051
(Z)-[(3Z,5Z)-2-methylidenenona-3,5,8-trienylidene]hydrazine (PubChem CID 89336051) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is (Z)-[(3Z,5Z)-2-methylidenenona-3,5,8-trienylidene]hydrazine.
| Compound Name | (Z)-[(3Z,5Z)-2-methylidenenona-3,5,8-trienylidene]hydrazine |
|---|---|
| PubChem CID | 89336051 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (Z)-[(3Z,5Z)-2-methylidenenona-3,5,8-trienylidene]hydrazine |
| SMILES | C=CC/C=C\C=C/C(=C)/C=N\N |
| InChI | InChI=1S/C10H14N2/c1-3-4-5-6-7-8-10(2)9-12-11/h3,5-9H,1-2,4,11H2/b6-5-,8-7-,12-9- |
| InChIKey | MDWRMHIQLHIAMF-SEDUXTPZSA-N |
| XLogP | 2.18 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|