C28H31BrN4O2 — CID 89337714
(10R,15S)-4-bromo-13-[3-(cyclobutylamino)propyl]-10-(3-hydroxyphenyl)-15-methyl-12-methylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one (PubChem CID 89337714) has the molecular formula C28H31BrN4O2 and a molecular weight of 535.49 g/mol. Its IUPAC name is (10R,15S)-4-bromo-13-[3-(cyclobutylamino)propyl]-10-(3-hydroxyphenyl)-15-methyl-12-methylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one.
| Compound Name | (10R,15S)-4-bromo-13-[3-(cyclobutylamino)propyl]-10-(3-hydroxyphenyl)-15-methyl-12-methylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one |
|---|---|
| PubChem CID | 89337714 |
| Molecular Formula | C28H31BrN4O2 |
| Molecular Weight | 535.49 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | (10R,15S)-4-bromo-13-[3-(cyclobutylamino)propyl]-10-(3-hydroxyphenyl)-15-methyl-12-methylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one |
| SMILES | C=C1N(CCCNC2CCC2)C(=O)[C@]2(C)Cc3c([nH]c4ccc(Br)cc34)[C@@H](c3cccc(O)c3)N12 |
| InChI | InChI=1S/C28H31BrN4O2/c1-17-32(13-5-12-30-20-7-4-8-20)27(35)28(2)16-23-22-15-19(29)10-11-24(22)31-25(23)26(33(17)28)18-6-3-9-21(34)14-18/h3,6,9-11,14-15,20,26,30-31,34H,1,4-5,7-8,12-13,16H2,2H3/t26-,28+/m1/s1 |
| InChIKey | JXSGUKPVENDQSW-IAPPQJPRSA-N |
| XLogP | 5.19 |
| TPSA | 71.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|