C10H15NO — CID 89339499
(3E,5Z)-2-(prop-1-en-2-ylamino)hepta-1,3,5-trien-3-ol (PubChem CID 89339499) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (3E,5Z)-2-(prop-1-en-2-ylamino)hepta-1,3,5-trien-3-ol.
| Compound Name | (3E,5Z)-2-(prop-1-en-2-ylamino)hepta-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 89339499 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (3E,5Z)-2-(prop-1-en-2-ylamino)hepta-1,3,5-trien-3-ol |
| SMILES | C=C(C)NC(=C)/C(O)=C\C=C/C |
| InChI | InChI=1S/C10H15NO/c1-5-6-7-10(12)9(4)11-8(2)3/h5-7,11-12H,2,4H2,1,3H3/b6-5-,10-7+ |
| InChIKey | WTLAKODPEQGSNW-ZZWPSLBBSA-N |
| XLogP | 2.64 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|