C8H12F2N2O — CID 89341936
5-(2,2-difluoroethoxy)-1,3,4-trimethylpyrazole (PubChem CID 89341936) has the molecular formula C8H12F2N2O and a molecular weight of 190.19 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)-1,3,4-trimethylpyrazole.
| Compound Name | 5-(2,2-difluoroethoxy)-1,3,4-trimethylpyrazole |
|---|---|
| PubChem CID | 89341936 |
| Molecular Formula | C8H12F2N2O |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 5-(2,2-difluoroethoxy)-1,3,4-trimethylpyrazole |
| SMILES | Cc1nn(C)c(OCC(F)F)c1C |
| InChI | InChI=1S/C8H12F2N2O/c1-5-6(2)11-12(3)8(5)13-4-7(9)10/h7H,4H2,1-3H3 |
| InChIKey | IERUBMQQDSPUIY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |