C7H11NO — CID 89344463
(1Z,3E)-1-amino-4-methylhexa-1,3,5-trien-3-ol (PubChem CID 89344463) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is (1Z,3E)-1-amino-4-methylhexa-1,3,5-trien-3-ol.
| Compound Name | (1Z,3E)-1-amino-4-methylhexa-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 89344463 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (1Z,3E)-1-amino-4-methylhexa-1,3,5-trien-3-ol |
| SMILES | C=C/C(C)=C(O)\C=C/N |
| InChI | InChI=1S/C7H11NO/c1-3-6(2)7(9)4-5-8/h3-5,9H,1,8H2,2H3/b5-4-,7-6+ |
| InChIKey | POMQOEOORCJHNJ-SCFJQAPRSA-N |
| XLogP | 1.48 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|