C6H9NO — CID 89205385
(3E,5Z)-6-aminohexa-1,3,5-trien-3-ol (PubChem CID 89205385) has the molecular formula C6H9NO and a molecular weight of 111.14 g/mol. Its IUPAC name is (3E,5Z)-6-aminohexa-1,3,5-trien-3-ol.
| Compound Name | (3E,5Z)-6-aminohexa-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 89205385 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | (3E,5Z)-6-aminohexa-1,3,5-trien-3-ol |
| SMILES | C=C/C(O)=C\C=C/N |
| InChI | InChI=1S/C6H9NO/c1-2-6(8)4-3-5-7/h2-5,8H,1,7H2/b5-3-,6-4+ |
| InChIKey | VDLIBLGYPLAENE-CIIODKQPSA-N |
| XLogP | 1.09 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|