C17H21NO — CID 89344788
2-[(1E,3Z,4E)-5-(dimethylamino)-3-ethylidenehepta-1,4,6-trienyl]phenol (PubChem CID 89344788) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-[(1E,3Z,4E)-5-(dimethylamino)-3-ethylidenehepta-1,4,6-trienyl]phenol.
| Compound Name | 2-[(1E,3Z,4E)-5-(dimethylamino)-3-ethylidenehepta-1,4,6-trienyl]phenol |
|---|---|
| PubChem CID | 89344788 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-[(1E,3Z,4E)-5-(dimethylamino)-3-ethylidenehepta-1,4,6-trienyl]phenol |
| SMILES | C=C/C(=C\C(=C/C)\C=C\c1ccccc1O)N(C)C |
| InChI | InChI=1S/C17H21NO/c1-5-14(13-16(6-2)18(3)4)11-12-15-9-7-8-10-17(15)19/h5-13,19H,2H2,1,3-4H3/b12-11+,14-5-,16-13+ |
| InChIKey | WQZJHSQDULUVAX-RDGINUNMSA-N |
| XLogP | 3.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|